|
Product Name | N7-methyl-Guanosine-5'-triphosphate-5'-Adenosine |
Synonyms | 7-Methylguanosine 5'-(tetrahydrogen triphosphate) inner salt, P''→5'-ester with adenosine;Adenosine 5'-(tetrahydrogen triphosphate), P''→5'-ester with 2-amino-6,9-dihydro-7-methyl-6-oxo-9-β-D-ribofuranosyl-1H-purinium inner salt;Guanosine 5'-(tetrahydrogen triphosphate), 7-methyl-, inner salt, P''→5'-ester with adenosine |
Catalog No. | A-2251 |
CAS No. | 62828-63-1 |
Molecular Formula | |
Molecular Weight | |
Smile Code | O=P(OOC[C@@H]1[C@H]([C@H]([C@H](N2CN(C)C3=C2N=C(N)NC3=O)O1)O)O)(OP([O-])(OP(OOC[C@@H]4[C@H]([C@H]([C@H](N5C=NC6=C(N=CN=C65)N)O4)O)O)([O-])=O)=O)[O-] |
InChI | |
EINECS | |
Density | |
Melting point | |
Boiling point | |
Refractive index | |
Water solubility | |
Hazard Symbols | |
Risk Codes | |
Safety Description |